CAS 1346707-84-3
:4-Chloro-2-[(4-pyridinylmethyl)thio]pyridine
Description:
4-Chloro-2-[(4-pyridinylmethyl)thio]pyridine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing nitrogen. The presence of a chloro group at the 4-position and a thioether linkage to a 4-pyridinylmethyl group at the 2-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the chloro and pyridine functionalities, which can participate in various chemical reactions. Additionally, the thioether moiety may enhance its lipophilicity and influence its interaction with biological targets. As with many pyridine derivatives, it may also exhibit interesting electronic properties, making it a candidate for further research in fields such as agrochemicals or materials science. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C11H9ClN2S
InChI:InChI=1S/C11H9ClN2S/c12-10-3-6-14-11(7-10)15-8-9-1-4-13-5-2-9/h1-7H,8H2
InChI key:InChIKey=XWPDRCCCPYSFHH-UHFFFAOYSA-N
SMILES:S(CC=1C=CN=CC1)C2=CC(Cl)=CC=N2
Synonyms:- Pyridine, 4-chloro-2-[(4-pyridinylmethyl)thio]-
- 4-Chloro-2-[(4-pyridinylmethyl)thio]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
