CymitQuimica logo

CAS 1346707-87-6

:

2-(2-Methylpropoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
2-(2-Methylpropoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a 2-methylpropoxy group and a boron-containing moiety. The presence of the dioxaborolane group suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions, which are valuable in synthetic organic chemistry. The compound's molecular structure indicates it may exhibit unique solubility properties, likely being soluble in organic solvents due to the hydrophobic alkyl groups. Additionally, the presence of the pyridine ring may impart basicity and potential coordination chemistry with metal ions. Its specific reactivity and stability would depend on the conditions of use, such as temperature and the presence of other reagents. Overall, this compound could serve as a useful intermediate in the synthesis of more complex organic molecules or materials, particularly in the fields of pharmaceuticals or agrochemicals.
Formula:C15H24BNO3
InChI:InChI=1S/C15H24BNO3/c1-11(2)10-18-13-9-12(7-8-17-13)16-19-14(3,4)15(5,6)20-16/h7-9,11H,10H2,1-6H3
InChI key:InChIKey=KUEJHWXWCLEZPL-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(OCC(C)C)N=CC2
Synonyms:
  • Pyridine, 2-(2-methylpropoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 2-(2-Methylpropoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.