CymitQuimica logo

CAS 1346707-89-8

:

2-(Pentyloxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
2-(Pentyloxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is an organic compound characterized by its pyridine ring, which is substituted with a pentyloxy group and a boron-containing moiety. The presence of the pentyloxy group contributes to its solubility in organic solvents and may influence its reactivity and interaction with other chemical species. The boron-containing group, specifically the tetramethyl-1,3,2-dioxaborolane, is notable for its potential applications in organic synthesis and materials science, particularly in the formation of boron-containing compounds and as a reagent in various chemical reactions. This compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the pyridine ring and the electron-donating characteristics of the pentyloxy group. Additionally, the steric bulk of the tetramethyl substituents can affect the compound's reactivity and stability. Overall, this compound is of interest in the fields of organic chemistry and materials science for its unique structural features and potential applications.
Formula:C16H26BNO3
InChI:InChI=1S/C16H26BNO3/c1-6-7-8-11-19-14-12-13(9-10-18-14)17-20-15(2,3)16(4,5)21-17/h9-10,12H,6-8,11H2,1-5H3
InChI key:InChIKey=DYQNWMAWHOMWLB-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(OCCCCC)N=CC2
Synonyms:
  • Pyridine, 2-(pentyloxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 2-(Pentyloxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.