CymitQuimica logo

CAS 1346707-91-2

:

2-(2-Methylbutoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
2-(2-Methylbutoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring and a dioxaborolane moiety. The presence of the 2-methylbutoxy group contributes to its solubility and potential reactivity, while the dioxaborolane group is known for its role in organoboron chemistry, particularly in cross-coupling reactions. This compound may exhibit properties such as moderate polarity due to the functional groups, and it could participate in various chemical reactions, including nucleophilic substitutions and coordination with metal catalysts. Its applications may extend to fields such as organic synthesis, materials science, and medicinal chemistry, where boron-containing compounds are often utilized for their unique reactivity and ability to form stable complexes. Safety and handling considerations should be taken into account, as with any chemical substance, particularly regarding its potential toxicity and environmental impact.
Formula:C16H26BNO3
InChI:InChI=1S/C16H26BNO3/c1-7-12(2)11-19-14-10-13(8-9-18-14)17-20-15(3,4)16(5,6)21-17/h8-10,12H,7,11H2,1-6H3
InChI key:InChIKey=UNCSJFISKJUAIB-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(OCC(CC)C)N=CC2
Synonyms:
  • 2-(2-Methylbutoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
  • Pyridine, 2-(2-methylbutoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.