CymitQuimica logo

CAS 1346707-92-3

:

2-(1-Methylbutoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
2-(1-Methylbutoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a 1-methylbutoxy group and a boron-containing moiety. The presence of the dioxaborolane group suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions, which are significant in synthetic organic chemistry. The compound's molecular structure indicates it may exhibit unique solubility properties and reactivity due to the steric hindrance provided by the tetramethyl groups. Additionally, the pyridine ring contributes to its potential as a ligand in coordination chemistry. The compound's specific physical properties, such as melting point, boiling point, and solubility, would depend on its purity and the conditions under which it is studied. Overall, this compound may be of interest in various fields, including pharmaceuticals, materials science, and catalysis, due to its functional groups and structural features.
Formula:C16H26BNO3
InChI:InChI=1S/C16H26BNO3/c1-7-8-12(2)19-14-11-13(9-10-18-14)17-20-15(3,4)16(5,6)21-17/h9-12H,7-8H2,1-6H3
InChI key:InChIKey=AVCKVBPSXDTFDK-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(OC(CCC)C)N=CC2
Synonyms:
  • Pyridine, 2-(1-methylbutoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 2-(1-Methylbutoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.