CymitQuimica logo

CAS 1346707-93-4

:

2-(1-Ethylpropoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
2-(1-Ethylpropoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, with CAS number 1346707-93-4, is a chemical compound that features a pyridine ring substituted with both an ethylpropoxy group and a boron-containing moiety. The presence of the dioxaborolane structure suggests that it may exhibit unique reactivity, particularly in terms of coordination chemistry and potential applications in organic synthesis or materials science. The ethylpropoxy group contributes to the compound's hydrophobic characteristics, potentially influencing its solubility and interaction with biological systems. Additionally, the tetramethyl substitution on the boron atom may enhance the stability and steric hindrance of the compound, affecting its reactivity and interactions with other molecules. Overall, this compound may be of interest in various fields, including medicinal chemistry and catalysis, due to its unique structural features and potential functional properties. Further studies would be necessary to fully elucidate its behavior and applications in different chemical contexts.
Formula:C16H26BNO3
InChI:InChI=1S/C16H26BNO3/c1-7-13(8-2)19-14-11-12(9-10-18-14)17-20-15(3,4)16(5,6)21-17/h9-11,13H,7-8H2,1-6H3
InChI key:InChIKey=KZFWSXPJHFADOC-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(OC(CC)CC)N=CC2
Synonyms:
  • Pyridine, 2-(1-ethylpropoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 2-(1-Ethylpropoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.