CymitQuimica logo

CAS 1346708-01-7

:

2-(Cyclopentylmethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
2-(Cyclopentylmethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a cyclopentylmethoxy group and a boron-containing moiety. The presence of the dioxaborolane group suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of boron-containing compounds that can participate in various chemical reactions, such as Suzuki coupling. The cyclopentylmethoxy group may enhance the lipophilicity and biological activity of the compound, making it of interest in pharmaceutical research. Additionally, the compound's molecular structure indicates potential for coordination chemistry due to the boron atom, which can interact with various nucleophiles. Overall, this compound exemplifies the intersection of organic chemistry and materials science, with implications for drug development and synthetic methodologies. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups.
Formula:C17H26BNO3
InChI:InChI=1S/C17H26BNO3/c1-16(2)17(3,4)22-18(21-16)14-9-10-19-15(11-14)20-12-13-7-5-6-8-13/h9-11,13H,5-8,12H2,1-4H3
InChI key:InChIKey=CNFZAFCZTTXZEW-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(OCC3CCCC3)N=CC2
Synonyms:
  • Pyridine, 2-(cyclopentylmethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 2-(Cyclopentylmethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.