CymitQuimica logo

CAS 1346708-02-8

:

2-(Cyclohexylmethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
2-(Cyclohexylmethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with both a cyclohexylmethoxy group and a boron-containing moiety. The presence of the dioxaborolane group suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of boron-containing compounds that can participate in various chemical reactions, such as cross-coupling reactions. The cyclohexylmethoxy group contributes to the compound's hydrophobic characteristics, potentially influencing its solubility and reactivity. Additionally, the compound's molecular structure may exhibit specific stereochemical properties due to the presence of the bulky tetramethyl groups, which can affect its interaction with biological targets. Overall, this compound's unique combination of functional groups and structural features makes it a candidate for further investigation in fields such as drug development and materials science.
Formula:C18H28BNO3
InChI:InChI=1S/C18H28BNO3/c1-17(2)18(3,4)23-19(22-17)15-10-11-20-16(12-15)21-13-14-8-6-5-7-9-14/h10-12,14H,5-9,13H2,1-4H3
InChI key:InChIKey=NAQJTVPEOYNZQX-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(OCC3CCCCC3)N=CC2
Synonyms:
  • 2-(Cyclohexylmethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
  • Pyridine, 2-(cyclohexylmethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.