
CAS 1346708-03-9
:2-[(2-Fluorophenyl)methoxy]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Description:
2-[(2-Fluorophenyl)methoxy]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring, a methoxy group, and a dioxaborolane moiety. The presence of the fluorophenyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the influence of fluorine on biological activity and lipophilicity. The dioxaborolane component is notable for its ability to form stable complexes with various substrates, making it useful in organic synthesis and catalysis. This compound may exhibit unique solubility properties and reactivity patterns due to its functional groups, which can affect its interactions in biological systems. Additionally, the presence of multiple functional groups indicates potential for diverse chemical reactivity, including nucleophilic substitution and coordination chemistry. Overall, this compound's structural features suggest it could be of interest in both research and industrial applications, particularly in the fields of organic synthesis and drug development.
Formula:C18H21BFNO3
InChI:InChI=1S/C18H21BFNO3/c1-17(2)18(3,4)24-19(23-17)14-9-10-21-16(11-14)22-12-13-7-5-6-8-15(13)20/h5-11H,12H2,1-4H3
InChI key:InChIKey=NVNOYKCUIAXLFR-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(OCC3=C(F)C=CC=C3)N=CC2
Synonyms:- Pyridine, 2-[(2-fluorophenyl)methoxy]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 2-[(2-Fluorophenyl)methoxy]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-((2-Fluorobenzyl)oxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
CAS:Formula:C18H21BFNO3Molecular weight:329.1736
