
CAS 1346708-07-3
:2-[(3-Methoxyphenyl)methoxy]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Description:
2-[(3-Methoxyphenyl)methoxy]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, identified by its CAS number 1346708-07-3, is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a methoxyphenyl group and a boron-containing moiety. The presence of the methoxy group enhances its solubility and may influence its electronic properties, while the dioxaborolane unit is known for its reactivity in various chemical transformations, particularly in cross-coupling reactions. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be significantly influenced by the presence of functional groups. It may also display interesting biological or pharmacological properties, making it a candidate for further research in medicinal chemistry. Overall, its unique structural features suggest potential applications in organic synthesis and materials science, particularly in the development of new catalysts or ligands.
Formula:C19H24BNO4
InChI:InChI=1S/C19H24BNO4/c1-18(2)19(3,4)25-20(24-18)15-9-10-21-17(12-15)23-13-14-7-6-8-16(11-14)22-5/h6-12H,13H2,1-5H3
InChI key:InChIKey=SGNGNOIXIXQKGZ-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(OCC3=CC(OC)=CC=C3)N=CC2
Synonyms:- Pyridine, 2-[(3-methoxyphenyl)methoxy]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 2-[(3-Methoxyphenyl)methoxy]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-((3-Methoxybenzyl)oxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
CAS:Formula:C19H24BNO4Molecular weight:341.2092
