CymitQuimica logo

CAS 1346708-08-4

:

2-[(4-Methoxyphenyl)methoxy]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
2-[(4-Methoxyphenyl)methoxy]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a complex organic compound characterized by its unique structural features, including a pyridine ring and a boron-containing moiety. The presence of the methoxyphenyl group contributes to its aromatic character, while the dioxaborolane unit enhances its reactivity and potential applications in organic synthesis, particularly in cross-coupling reactions. This compound is likely to exhibit moderate to high solubility in organic solvents due to its non-polar aromatic components. Its molecular structure suggests potential applications in medicinal chemistry and materials science, particularly in the development of boron-containing compounds for drug delivery or as intermediates in the synthesis of more complex molecules. The presence of the boron atom may also impart unique properties, such as the ability to form complexes with various ligands. Overall, this compound represents a versatile building block in organic synthesis, with implications for both academic research and industrial applications.
Formula:C19H24BNO4
InChI:InChI=1S/C19H24BNO4/c1-18(2)19(3,4)25-20(24-18)15-10-11-21-17(12-15)23-13-14-6-8-16(22-5)9-7-14/h6-12H,13H2,1-5H3
InChI key:InChIKey=CZOSHSREWDHZQR-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(OCC3=CC=C(OC)C=C3)N=CC2
Synonyms:
  • 2-[(4-Methoxyphenyl)methoxy]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
  • Pyridine, 2-[(4-methoxyphenyl)methoxy]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.