
CAS 1346708-09-5
:4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[[2-(trifluoromethyl)phenyl]methoxy]pyridine
Description:
The chemical substance known as 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[[2-(trifluoromethyl)phenyl]methoxy]pyridine, with the CAS number 1346708-09-5, is a complex organic compound featuring a pyridine ring substituted with a methoxy group and a trifluoromethylphenyl moiety. The presence of the dioxaborolane group indicates that it may have applications in organoboron chemistry, particularly in cross-coupling reactions, which are valuable in the synthesis of pharmaceuticals and agrochemicals. The trifluoromethyl group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the tetramethyl substituents on the dioxaborolane contribute to the compound's stability and steric hindrance, which can affect its reactivity. Overall, this compound exemplifies the intricate design often found in modern synthetic chemistry, where specific functional groups are strategically incorporated to achieve desired properties and reactivity profiles.
Formula:C19H21BF3NO3
InChI:InChI=1S/C19H21BF3NO3/c1-17(2)18(3,4)27-20(26-17)14-9-10-24-16(11-14)25-12-13-7-5-6-8-15(13)19(21,22)23/h5-11H,12H2,1-4H3
InChI key:InChIKey=HVLYCCIKDKQLLV-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(OCC3=C(C(F)(F)F)C=CC=C3)N=CC2
Synonyms:- Pyridine, 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[[2-(trifluoromethyl)phenyl]methoxy]-
- 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[[2-(trifluoromethyl)phenyl]methoxy]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-((2-(trifluoromethyl)benzyl)oxy)pyridine
CAS:Formula:C19H21BF3NO3Molecular weight:379.1811
