
CAS 1346708-10-8
:4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[[3-(trifluoromethyl)phenyl]methoxy]pyridine
Description:
The chemical substance known as "4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[[3-(trifluoromethyl)phenyl]methoxy]pyridine" with CAS number 1346708-10-8 is a complex organic compound featuring a pyridine ring substituted with a methoxy group and a trifluoromethylphenyl moiety. The presence of the dioxaborolane group indicates that it contains boron, which is often utilized in organic synthesis and medicinal chemistry for its ability to form stable complexes and facilitate various reactions. The trifluoromethyl group enhances the compound's lipophilicity and may influence its biological activity, making it potentially useful in pharmaceutical applications. The tetramethyl substituents contribute to the steric bulk around the boron atom, which can affect the compound's reactivity and stability. Overall, this compound exemplifies the intricate design often found in modern organic chemistry, particularly in the development of new materials or drug candidates. Its specific properties, such as solubility, melting point, and reactivity, would require empirical measurement or detailed computational analysis for precise characterization.
Formula:C19H21BF3NO3
InChI:InChI=1S/C19H21BF3NO3/c1-17(2)18(3,4)27-20(26-17)15-8-9-24-16(11-15)25-12-13-6-5-7-14(10-13)19(21,22)23/h5-11H,12H2,1-4H3
InChI key:InChIKey=ALAMAIVVAPVFNJ-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(OCC3=CC(C(F)(F)F)=CC=C3)N=CC2
Synonyms:- Pyridine, 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[[3-(trifluoromethyl)phenyl]methoxy]-
- 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[[3-(trifluoromethyl)phenyl]methoxy]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-((3-(trifluoromethyl)benzyl)oxy)pyridine
CAS:Formula:C19H21BF3NO3Molecular weight:379.1811
