CymitQuimica logo

CAS 1346708-16-4

:

1,1-Dimethylethyl N-[2-[(4-chloro-2-pyridinyl)oxy]ethyl]carbamate

Description:
1,1-Dimethylethyl N-[2-[(4-chloro-2-pyridinyl)oxy]ethyl]carbamate, identified by its CAS number 1346708-16-4, is a chemical compound that belongs to the class of carbamates. This substance typically exhibits characteristics common to carbamate derivatives, such as being a potential herbicide or pesticide, given its structural features that suggest biological activity. The presence of the 4-chloro-2-pyridinyl moiety indicates potential interactions with biological systems, particularly in targeting specific enzymes or receptors. The dimethyl group contributes to the steric hindrance, which may influence its reactivity and solubility in various solvents. Additionally, the compound's stability and efficacy can be affected by environmental factors, including pH and temperature. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the compound may pose risks to human health and the environment. Overall, its unique structure suggests a specialized role in agricultural applications, although specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C12H17ClN2O3
InChI:InChI=1S/C12H17ClN2O3/c1-12(2,3)18-11(16)15-6-7-17-10-8-9(13)4-5-14-10/h4-5,8H,6-7H2,1-3H3,(H,15,16)
InChI key:InChIKey=DVRGJJXOKOCHAU-UHFFFAOYSA-N
SMILES:O(CCNC(OC(C)(C)C)=O)C1=CC(Cl)=CC=N1
Synonyms:
  • Carbamic acid, N-[2-[(4-chloro-2-pyridinyl)oxy]ethyl]-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl N-[2-[(4-chloro-2-pyridinyl)oxy]ethyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.