CAS 1346708-17-5
:2-[(4-Chloro-2-pyridinyl)oxy]-N-methylethanamine
Description:
2-[(4-Chloro-2-pyridinyl)oxy]-N-methylethanamine, identified by its CAS number 1346708-17-5, is a chemical compound characterized by its unique structure that includes a pyridine ring substituted with a chlorine atom and an ether linkage. This compound features a methylethanamine moiety, which contributes to its potential biological activity. The presence of the chloro substituent on the pyridine ring may influence its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. The compound is likely to exhibit polar characteristics due to the amine and ether functional groups, which can affect its solubility and permeability in biological systems. Additionally, the presence of the pyridine ring suggests potential applications in pharmaceuticals, particularly in the development of agents targeting specific receptors or enzymes. Overall, this compound's structural features indicate that it may possess interesting pharmacological properties, warranting further investigation in drug discovery and development contexts.
Formula:C8H11ClN2O
InChI:InChI=1S/C8H11ClN2O/c1-10-4-5-12-8-6-7(9)2-3-11-8/h2-3,6,10H,4-5H2,1H3
InChI key:InChIKey=AOCMLFAYNRYYHT-UHFFFAOYSA-N
SMILES:O(CCNC)C1=CC(Cl)=CC=N1
Synonyms:- Ethanamine, 2-[(4-chloro-2-pyridinyl)oxy]-N-methyl-
- 2-[(4-Chloro-2-pyridinyl)oxy]-N-methylethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
