
CAS 1346708-21-1
:3-[(4-Chloro-2-pyridinyl)oxy]-N-methyl-1-propanamine
Description:
3-[(4-Chloro-2-pyridinyl)oxy]-N-methyl-1-propanamine, identified by its CAS number 1346708-21-1, is a chemical compound characterized by its unique molecular structure that includes a pyridine ring substituted with a chlorine atom and an ether linkage. This compound features a propanamine backbone with a methyl group attached to the nitrogen atom, contributing to its amine properties. The presence of the chloro and pyridine groups suggests potential biological activity, making it of interest in pharmaceutical research. Its solubility and stability can vary depending on the solvent and environmental conditions, which are critical for its application in synthesis or as a potential drug candidate. Additionally, the compound's reactivity may be influenced by the electron-withdrawing nature of the chloro group and the basicity of the amine, affecting its interactions in biological systems. Overall, this compound exemplifies the complexity of organic molecules that can be tailored for specific functions in medicinal chemistry.
Formula:C9H13ClN2O
InChI:InChI=1S/C9H13ClN2O/c1-11-4-2-6-13-9-7-8(10)3-5-12-9/h3,5,7,11H,2,4,6H2,1H3
InChI key:InChIKey=VGFONFCYLYOPAR-UHFFFAOYSA-N
SMILES:O(CCCNC)C1=CC(Cl)=CC=N1
Synonyms:- 1-Propanamine, 3-[(4-chloro-2-pyridinyl)oxy]-N-methyl-
- 3-[(4-Chloro-2-pyridinyl)oxy]-N-methyl-1-propanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
