CAS 134671-61-7

2-(4-Bromo-2-methylphenoxy)acetaldehyde

Description:

2-(4-Bromo-2-methylphenoxy)acetaldehyde is an organic compound characterized by its unique structure, which includes a brominated aromatic ring and an aldehyde functional group. The presence of the bromine atom enhances its reactivity and can influence its physical properties, such as solubility and boiling point. This compound typically appears as a colorless to pale yellow liquid and has a distinct odor. It is soluble in organic solvents, reflecting its non-polar characteristics due to the aromatic ring. The aldehyde group is reactive, making it susceptible to oxidation and condensation reactions. Additionally, the compound may exhibit biological activity, which can be of interest in pharmaceutical and agrochemical applications. Its synthesis often involves the reaction of appropriate phenolic compounds with acetaldehyde derivatives, and it may be used as an intermediate in the production of more complex organic molecules. Safety precautions should be taken when handling this compound, as it may pose health risks due to its bromine content and reactive aldehyde group.

Formula: C₉H₉BrO₂

InChI: InChI=1S/C9H9BrO2/c1-7-6-8(10)2-3-9(7)12-5-4-11/h2-4,6H,5H2,1H3

InChI key: InChIKey=RAPLYOAXTMEOSH-UHFFFAOYSA-N

SMILES: O(CC=O)C1=C(C)C=C(Br)C=C1

Synonyms:

• 2-(4-Bromo-2-methylphenoxy)acetaldehyde
• Acetaldehyde, 2-(4-bromo-2-methylphenoxy)-
• Acetaldehyde, (4-bromo-2-methylphenoxy)-