CymitQuimica logo

CAS 134676-66-7

:

2-Thiomorpholinecarboxylic acid

Description:
2-Thiomorpholinecarboxylic acid is a heterocyclic compound characterized by the presence of a thiomorpholine ring, which is a six-membered ring containing both sulfur and nitrogen atoms. This compound features a carboxylic acid functional group, which contributes to its acidic properties. The presence of the thiomorpholine structure imparts unique chemical reactivity and potential biological activity, making it of interest in medicinal chemistry and organic synthesis. Typically, thiomorpholine derivatives exhibit properties such as moderate solubility in polar solvents and stability under standard laboratory conditions. The compound may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, due to the functional groups present. Its potential applications could range from pharmaceuticals to agrochemicals, depending on the specific modifications and derivatives synthesized from it. As with many sulfur-containing compounds, it may also exhibit distinct odor characteristics. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C5H9NO2S
InChI:InChI=1S/C5H9NO2S/c7-5(8)4-3-6-1-2-9-4/h4,6H,1-3H2,(H,7,8)
InChI key:InChIKey=ATOPRCUIYMBWLH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CNCCS1
Synonyms:
  • 2-Thiomorpholinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.