
CAS 1346773-61-2
:1,5-Dimethyl N-benzoyl-D-glutamate
Description:
1,5-Dimethyl N-benzoyl-D-glutamate is a chemical compound characterized by its structure, which includes a benzoyl group and a glutamate moiety. This compound is a derivative of glutamic acid, an amino acid that plays a crucial role in various biological processes. The presence of the dimethyl groups indicates that there are two methyl substituents on the nitrogen atom, which can influence the compound's solubility and reactivity. The benzoyl group contributes to the compound's aromatic characteristics and may enhance its stability and interaction with other molecules. Typically, compounds like this may exhibit properties such as being a potential intermediate in organic synthesis or having applications in pharmaceuticals or biochemistry. Its specific interactions, stability, and reactivity would depend on the surrounding conditions, such as pH and temperature. As with many chemical substances, safety data and handling precautions should be considered when working with this compound in a laboratory setting.
Formula:C14H17NO5
InChI:InChI=1S/C14H17NO5/c1-19-12(16)9-8-11(14(18)20-2)15-13(17)10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3,(H,15,17)/t11-/m1/s1
InChI key:InChIKey=JOTSRQZZNLVBKG-LLVKDONJSA-N
SMILES:[C@@H](NC(=O)C1=CC=CC=C1)(CCC(OC)=O)C(OC)=O
Synonyms:- D-Glutamic acid, N-benzoyl-, 1,5-dimethyl ester
- 1,5-Dimethyl N-benzoyl-D-glutamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
