CAS 13468-88-7

4-Cyclohexene-1,2-dicarboxylic acid, 4-methyl- (6CI,7CI,8CI,9CI)

Description:

4-Cyclohexene-1,2-dicarboxylic acid, 4-methyl- is an organic compound characterized by its cyclohexene structure, which features a double bond within a six-membered carbon ring. This compound contains two carboxylic acid functional groups (-COOH) at the 1 and 2 positions, contributing to its acidity and reactivity. The presence of a methyl group at the 4-position adds to its molecular complexity and influences its physical and chemical properties. Typically, compounds of this nature are used in organic synthesis and may serve as intermediates in the production of various chemicals, including polymers and pharmaceuticals. The compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid groups, while its cyclohexene ring may impart some hydrophobic characteristics. Additionally, the presence of multiple functional groups suggests potential for various chemical reactions, including esterification and polymerization. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₉H₁₂O₄

InChI: InChI=1/C9H12O4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2,6-7H,3-4H2,1H3,(H,10,11)(H,12,13)/t6-,7-/m0/s1

SMILES: CC1=CC[C@@H]([C@H](C1)C(=O)O)C(=O)O

Synonyms:

• 4-Methyl-4-Cyclohexene-1,2-Dicarboxylic Anhydride 95%
• 4-Methylcyclohex-4-Ene-1,2-Dicarboxylic Acid
• (1S,2S)-4-methylcyclohex-4-ene-1,2-dicarboxylic acid