CAS 134680-32-3: 2′,3′-Dideoxy-3′-thiacytidine
Description:2′,3′-Dideoxy-3′-thiacytidine, also known as T-705 or a related compound, is a nucleoside analog that exhibits antiviral properties, particularly against certain RNA viruses. This compound features a sulfur atom in place of the oxygen in the ribose sugar moiety, which contributes to its unique biochemical properties. It is characterized by its ability to inhibit viral replication by interfering with the viral RNA synthesis process. The presence of the dideoxy group means that it lacks a hydroxyl group at the 2' and 3' positions of the sugar, which is crucial for the formation of the phosphodiester bond during nucleic acid synthesis. This structural modification enhances its stability and efficacy as an antiviral agent. Additionally, 2′,3′-Dideoxy-3′-thiacytidine has been studied for its potential use in treating various viral infections, including those caused by retroviruses. Its pharmacokinetics, toxicity, and therapeutic applications are subjects of ongoing research in the field of medicinal chemistry and virology.
Formula:C8H11N3O3S
InChI:InChI=1S/C8H11N3O3S/c9-5-1-2-11(8(13)10-5)6-4-15-7(3-12)14-6/h1-2,6-7,12H,3-4H2,(H2,9,10,13)/t6-,7+/m1/s1
InChI key:InChIKey=JTEGQNOMFQHVDC-RQJHMYQMSA-N
SMILES:O=C1N=C(N)C=CN1C2OC(SC2)CO
![4-Amino-1-[(2S,5R)-2-(hydroxy-methyl)-1,3-oxathiolan-5-yl]pyrimidin-2(1H)-one](https://static.cymitquimica.com/products/86/thumb/MM0749.04-0025.jpg)
![4-amino-1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-1,2-dihydropyrimidin-2-one](https://static.cymitquimica.com/products/10/thumb/F520514.jpg)
