CymitQuimica logo

CAS 1346808-32-9

:

2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,4-oxadiazole

Description:
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,4-oxadiazole is a chemical compound characterized by its unique structural features, which include a dioxaborolane moiety and an oxadiazole ring. The presence of the dioxaborolane group suggests that this compound may exhibit properties related to boron chemistry, such as potential reactivity in cross-coupling reactions or as a boron source in various applications. The oxadiazole ring contributes to the compound's stability and may impart specific electronic properties, making it of interest in materials science and organic electronics. Additionally, the tetramethyl substituents enhance the steric bulk around the boron atom, which can influence the compound's solubility and reactivity. Overall, this compound may find applications in organic synthesis, medicinal chemistry, or as a building block in the development of functional materials, although specific applications would depend on further research into its properties and behavior in various chemical environments.
Formula:C8H13BN2O3
InChI:InChI=1S/C8H13BN2O3/c1-7(2)8(3,4)14-9(13-7)6-11-10-5-12-6/h5H,1-4H3
InChI key:InChIKey=DBJNYCLMPZVSCD-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=NN=CO2
Synonyms:
  • 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,4-oxadiazole
  • 1,3,4-Oxadiazole, 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.