CymitQuimica logo

CAS 1346808-34-1

:

5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,4-thiadiazole

Description:
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,4-thiadiazole is a chemical compound characterized by its unique structural features, which include a thiadiazole ring and a boron-containing dioxaborolane moiety. The thiadiazole part contributes to its potential biological activity, as thiadiazoles are known for their diverse pharmacological properties. The presence of the dioxaborolane group enhances its reactivity and solubility, making it useful in various synthetic applications, particularly in organic synthesis and materials science. This compound may exhibit interesting electronic properties due to the interaction between the boron atom and the thiadiazole ring, potentially leading to applications in organic electronics or as a ligand in coordination chemistry. Additionally, its stability and reactivity can be influenced by environmental factors such as temperature and pH. Overall, this compound represents a valuable structure in the field of chemistry, with potential implications in medicinal chemistry and materials development.
Formula:C8H13BN2O2S
InChI:InChI=1S/C8H13BN2O2S/c1-7(2)8(3,4)13-9(12-7)6-10-5-11-14-6/h5H,1-4H3
InChI key:InChIKey=MCAHQWYFLUUEDH-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=NC=NS2
Synonyms:
  • 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,4-thiadiazole
  • 1,2,4-Thiadiazole, 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.