CymitQuimica logo

CAS 1346808-45-4

:

5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3-thiadiazole

Description:
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3-thiadiazole is a chemical compound characterized by its unique structural features, which include a thiadiazole ring and a boron-containing dioxaborolane moiety. The thiadiazole part contributes to its potential biological activity, often associated with heterocyclic compounds, while the dioxaborolane group enhances its reactivity and solubility in various organic solvents. This compound may exhibit properties such as fluorescence or photostability, making it of interest in materials science and medicinal chemistry. Its boron content suggests potential applications in organic synthesis and as a building block in the development of boron-containing pharmaceuticals. Additionally, the presence of bulky tetramethyl groups can influence its steric properties, potentially affecting its interactions with other molecules. Overall, this compound represents a versatile structure that could be explored for various applications in chemical research and development.
Formula:C8H13BN2O2S
InChI:InChI=1S/C8H13BN2O2S/c1-7(2)8(3,4)13-9(12-7)6-5-10-11-14-6/h5H,1-4H3
InChI key:InChIKey=ROQFDUXNHWWUAP-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CN=NS2
Synonyms:
  • 1,2,3-Thiadiazole, 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3-thiadiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.