
CAS 1346808-50-1
:N-Cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine
Description:
N-Cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine is a chemical compound characterized by its unique structure, which includes a pyridine ring and a dioxaborolane moiety. The presence of the cyclohexyl group contributes to its hydrophobic characteristics, while the dioxaborolane unit is known for its ability to form stable complexes with various substrates, making it useful in organic synthesis and medicinal chemistry. This compound may exhibit interesting biological activities due to the pyridinamine functionality, which can participate in hydrogen bonding and coordination with biological targets. Its molecular structure suggests potential applications in drug development, particularly in the design of compounds with specific interactions in biological systems. Additionally, the presence of the boron atom in the dioxaborolane can enhance reactivity and selectivity in chemical reactions, making it a valuable building block in synthetic organic chemistry. Overall, this compound exemplifies the intersection of organic chemistry and pharmacology, with potential implications in various research fields.
Formula:C17H27BN2O2
InChI:InChI=1S/C17H27BN2O2/c1-16(2)17(3,4)22-18(21-16)13-10-11-19-15(12-13)20-14-8-6-5-7-9-14/h10-12,14H,5-9H2,1-4H3,(H,19,20)
InChI key:InChIKey=ZMEJZACDUZAAOV-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(NC3CCCCC3)N=CC2
Synonyms:- 2-Pyridinamine, N-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- N-Cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Pyridinamine, N-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
CAS:Formula:C17H27BN2O2Molecular weight:302.2195
