
CAS 1346808-84-1
:2-[3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]propyl]phenol
Description:
2-[3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]propyl]phenol, with CAS number 1346808-84-1, is an organosilicon compound characterized by the presence of a phenolic group and a siloxane moiety. This compound features a tert-butyl group attached to a dimethylsilyl group, which enhances its hydrophobic properties and thermal stability. The structure includes a propyl chain linking the phenol to the siloxane, contributing to its potential applications in various fields, including materials science and polymer chemistry. The presence of the phenolic hydroxyl group suggests that it may exhibit antioxidant properties, making it useful in stabilizing formulations against oxidative degradation. Additionally, the siloxane component can impart flexibility and durability to materials, making this compound of interest in the development of silicone-based products. Overall, its unique combination of organic and inorganic characteristics allows for diverse applications, particularly in enhancing the performance of coatings, adhesives, and sealants.
Formula:C15H26O2Si
InChI:InChI=1S/C15H26O2Si/c1-15(2,3)18(4,5)17-12-8-10-13-9-6-7-11-14(13)16/h6-7,9,11,16H,8,10,12H2,1-5H3
InChI key:InChIKey=YDSBBEIUUUYOFR-UHFFFAOYSA-N
SMILES:C(CCO[Si](C(C)(C)C)(C)C)C1=C(O)C=CC=C1
Synonyms:- Phenol, 2-[3-[[(1,1-dimethylethyl)dimethylsilyl]oxy]propyl]-
- 2-[3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]propyl]phenol
- 2-(3-((tert-Butyldimethylsilyl)oxy)propyl)phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.