CAS 1346809-07-1
:2-Methyl-2-propanyl 1,3-oxazol-5-ylcarbamate
Description:
2-Methyl-2-propanyl 1,3-oxazol-5-ylcarbamate, identified by its CAS number 1346809-07-1, is a chemical compound that features a carbamate functional group linked to an oxazole ring. This compound is characterized by its potential use in agricultural applications, particularly as a pesticide or herbicide, due to its biological activity. The presence of the oxazole ring contributes to its stability and reactivity, while the carbamate moiety is known for its ability to interact with biological systems, often inhibiting specific enzymes. Physically, it may exhibit properties typical of organic compounds, such as moderate solubility in organic solvents and varying stability under different environmental conditions. The compound's molecular structure suggests it may participate in various chemical reactions, making it of interest in synthetic organic chemistry. Safety and handling precautions are essential, as with many chemical substances, to mitigate any potential hazards associated with its use. Further studies would be necessary to fully elucidate its properties and applications in various fields.
Formula:C8H12N2O3
InChI:InChI=1S/C8H12N2O3/c1-8(2,3)13-7(11)10-6-4-9-5-12-6/h4-5H,1-3H3,(H,10,11)
SMILES:CC(C)(C)OC(=Nc1cnco1)O
Synonyms:- tert-Butyl oxazol-5-ylcarbamate
- tert-Butyloxazol-5-ylcarbamate
- Oxazol-5-yl-carbamic acid tert-butyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
tert-Butyl oxazol-5-ylcarbamate
CAS:Formula:C8H12N2O3Purity:97%Color and Shape:SolidMolecular weight:184.1925tert-Butyl oxazol-5-ylcarbamate
CAS:tert-Butyl oxazol-5-ylcarbamatePurity:97%Molecular weight:184.19g/moltert-Butyl oxazol-5-ylcarbamate
CAS:Formula:C8H12N2O3Purity:97%Color and Shape:LiquidMolecular weight:184.195tert-Butyl oxazol-5-ylcarbamate
CAS:<p>Please enquire for more information about tert-Butyl oxazol-5-ylcarbamate including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C8H12N2O3Purity:Min. 95%Molecular weight:184.19 g/mol



