CymitQuimica logo

CAS 1346809-11-7

:

4-Chloro-2-(2,2,2-trifluoroethoxy)pyridine

Description:
4-Chloro-2-(2,2,2-trifluoroethoxy)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 4-position and a trifluoroethoxy group at the 2-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It exhibits moderate polarity due to the electronegative chlorine and trifluoromethyl groups, which can influence its solubility in various solvents. The trifluoroethoxy group enhances its lipophilicity, making it potentially useful in pharmaceutical applications. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Its reactivity can be influenced by the presence of the electronegative substituents, making it a candidate for further chemical transformations. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.
Formula:C7H5ClF3NO
InChI:InChI=1S/C7H5ClF3NO/c8-5-1-2-12-6(3-5)13-4-7(9,10)11/h1-3H,4H2
InChI key:InChIKey=UQUDIOBRPUWRHV-UHFFFAOYSA-N
SMILES:O(CC(F)(F)F)C1=CC(Cl)=CC=N1
Synonyms:
  • 4-Chloro-2-(2,2,2-trifluoroethoxy)pyridine
  • Pyridine, 4-chloro-2-(2,2,2-trifluoroethoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.