CAS 1346809-16-2
:Methyl 2-[(4-chloro-2-pyridinyl)thio]acetate
Description:
Methyl 2-[(4-chloro-2-pyridinyl)thio]acetate is an organic compound characterized by its ester functional group, which is derived from acetic acid and a thioether moiety. The presence of a pyridine ring, specifically substituted with a chlorine atom at the 4-position, contributes to its unique chemical properties, including potential biological activity. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents, which is common for esters, but may have limited solubility in water due to its hydrophobic characteristics. The thioether linkage introduces sulfur into the structure, which can influence reactivity and stability. Methyl 2-[(4-chloro-2-pyridinyl)thio]acetate may be of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential applications as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as compounds containing chlorine and sulfur can pose specific health and environmental risks.
Formula:C8H8ClNO2S
InChI:InChI=1S/C8H8ClNO2S/c1-12-8(11)5-13-7-4-6(9)2-3-10-7/h2-4H,5H2,1H3
InChI key:InChIKey=WIBMMZXESPNIDC-UHFFFAOYSA-N
SMILES:S(CC(OC)=O)C1=CC(Cl)=CC=N1
Synonyms:- Acetic acid, 2-[(4-chloro-2-pyridinyl)thio]-, methyl ester
- Methyl 2-[(4-chloro-2-pyridinyl)thio]acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
