CAS 1346809-22-0

α-(Trifluoromethyl)-1-(triphenylmethyl)-1H-imidazole-4-methanol

Description:

α-(Trifluoromethyl)-1-(triphenylmethyl)-1H-imidazole-4-methanol is a chemical compound characterized by its imidazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms. The presence of a trifluoromethyl group (-CF3) enhances its lipophilicity and can influence its electronic properties, making it potentially useful in various chemical applications. The triphenylmethyl group, known for its stability and ability to act as a protecting group in organic synthesis, contributes to the compound's overall steric bulk and can affect its reactivity. The hydroxymethyl (-CH2OH) substituent at the 4-position of the imidazole ring introduces a polar functional group, which may enhance solubility in polar solvents and influence hydrogen bonding interactions. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for further research in medicinal chemistry. Overall, its unique combination of functional groups and structural characteristics positions it as a compound of interest in both synthetic and applied chemistry contexts.

Formula: C₂₄H₁₉F₃N₂O

InChI: InChI=1S/C24H19F3N2O/c25-24(26,27)22(30)21-16-29(17-28-21)23(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-17,22,30H

InChI key: InChIKey=IWFBCRPQDKFBPC-UHFFFAOYSA-N

SMILES: C(N1C=C(C(C(F)(F)F)O)N=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4

Synonyms:

• α-(Trifluoromethyl)-1-(triphenylmethyl)-1H-imidazole-4-methanol
• 1H-Imidazole-4-methanol, α-(trifluoromethyl)-1-(triphenylmethyl)-