CAS 1346809-26-4
:5-(6-Chloro-3-pyridazinyl)-3-pyridinemethanol
Description:
5-(6-Chloro-3-pyridazinyl)-3-pyridinemethanol is a chemical compound characterized by its unique structure, which includes a pyridazine ring and a pyridine ring, both of which are nitrogen-containing heterocycles. The presence of a chloro substituent on the pyridazine ring contributes to its reactivity and potential biological activity. This compound features a hydroxymethyl group (-CH2OH) attached to the pyridine, which can influence its solubility and interaction with biological targets. Typically, compounds of this nature may exhibit properties such as antimicrobial, anti-inflammatory, or other pharmacological activities, making them of interest in medicinal chemistry. The molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can affect its behavior in biological systems. Additionally, the compound's stability, solubility, and potential toxicity would be important factors to consider in its application in research or pharmaceuticals. Overall, 5-(6-Chloro-3-pyridazinyl)-3-pyridinemethanol represents a class of compounds that could have significant implications in drug development and therapeutic applications.
Formula:C10H8ClN3O
InChI:InChI=1S/C10H8ClN3O/c11-10-2-1-9(13-14-10)8-3-7(6-15)4-12-5-8/h1-5,15H,6H2
InChI key:InChIKey=CHSLNEBIJHYJBM-UHFFFAOYSA-N
SMILES:C(O)C1=CC(=CN=C1)C2=CC=C(Cl)N=N2
Synonyms:- 5-(6-Chloro-3-pyridazinyl)-3-pyridinemethanol
- 3-Pyridinemethanol, 5-(6-chloro-3-pyridazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
