
CAS 1346809-43-5
:4-Pyridinamine, 2-chloro-6-(2,2,2-trifluoroethoxy)-
Description:
4-Pyridinamine, 2-chloro-6-(2,2,2-trifluoroethoxy)- is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of an amino group (-NH2) at the 4-position and a chloro substituent at the 2-position contributes to its reactivity and potential applications in various chemical reactions. The 6-position features a 2,2,2-trifluoroethoxy group, which introduces significant electronegativity and hydrophobic characteristics due to the presence of trifluoromethyl groups. This compound may exhibit unique properties such as increased lipophilicity and altered solubility in organic solvents. Its molecular structure suggests potential uses in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Additionally, the presence of fluorine atoms can enhance biological activity and stability. As with many chemical substances, safety and handling precautions should be observed, given the potential hazards associated with halogenated compounds.
Formula:C7H6ClF3N2O
InChI:InChI=1S/C7H6ClF3N2O/c8-5-1-4(12)2-6(13-5)14-3-7(9,10)11/h1-2H,3H2,(H2,12,13)
InChI key:InChIKey=MHIAQRHELCOCTK-UHFFFAOYSA-N
SMILES:O(CC(F)(F)F)C1=CC(N)=CC(Cl)=N1
Synonyms:- 2-Chloro-6-(2,2,2-trifluoroethoxy)pyridin-4-amine
- 4-Pyridinamine, 2-chloro-6-(2,2,2-trifluoroethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
