CAS 1346809-46-8
:5-Bromo-2-[(2-methoxyethyl)amino]-3-pyridinecarbonitrile
Description:
5-Bromo-2-[(2-methoxyethyl)amino]-3-pyridinecarbonitrile is a chemical compound characterized by its pyridine ring, which is substituted at the 5-position with a bromine atom and at the 2-position with a 2-methoxyethylamino group. The presence of the cyano group (-C≡N) at the 3-position contributes to its reactivity and potential applications in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the methoxyethyl group, which enhances its hydrophilicity. The bromine atom introduces a halogen, which can participate in various chemical reactions, including nucleophilic substitutions. The compound's structure suggests potential biological activity, making it of interest in medicinal chemistry. Its molecular properties, such as melting point, boiling point, and spectral characteristics, would be determined through experimental methods. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 5-Bromo-2-[(2-methoxyethyl)amino]-3-pyridinecarbonitrile is a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C9H10BrN3O
InChI:InChI=1S/C9H10BrN3O/c1-14-3-2-12-9-7(5-11)4-8(10)6-13-9/h4,6H,2-3H2,1H3,(H,12,13)
InChI key:InChIKey=OVZHDAICXDIIGJ-UHFFFAOYSA-N
SMILES:N(CCOC)C1=C(C#N)C=C(Br)C=N1
Synonyms:- 3-Pyridinecarbonitrile, 5-bromo-2-[(2-methoxyethyl)amino]-
- 5-Bromo-2-[(2-methoxyethyl)amino]-3-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
