
CAS 1346809-67-3
:4-Chloro-2-(pentyloxy)pyridine
Description:
4-Chloro-2-(pentyloxy)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 4-position and a pentyloxy group at the 2-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative chlorine and the alkoxy group, which can influence its solubility in various solvents. The pentyloxy group, being a longer alkyl chain, may enhance hydrophobic interactions, affecting its behavior in biological systems or chemical reactions. Additionally, the compound may participate in nucleophilic substitution reactions due to the presence of the chlorine atom, making it a potential candidate for further chemical modifications. Its structural features suggest potential applications in pharmaceuticals or agrochemicals, where pyridine derivatives are often utilized for their biological activity. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.
Formula:C10H14ClNO
InChI:InChI=1S/C10H14ClNO/c1-2-3-4-7-13-10-8-9(11)5-6-12-10/h5-6,8H,2-4,7H2,1H3
InChI key:InChIKey=DHGQOYIYSFVBOJ-UHFFFAOYSA-N
SMILES:O(CCCCC)C1=CC(Cl)=CC=N1
Synonyms:- Pyridine, 4-chloro-2-(pentyloxy)-
- 4-Chloro-2-(pentyloxy)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
