CymitQuimica logo

CAS 1346809-68-4

:

4-Chloro-2-(3-methylbutoxy)pyridine

Description:
4-Chloro-2-(3-methylbutoxy)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 4-position and a 3-methylbutoxy group at the 2-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative chlorine and the ether-like characteristics of the butoxy group. It may participate in various chemical reactions typical of pyridine derivatives, such as electrophilic substitution and nucleophilic reactions, owing to the electron-withdrawing nature of the chlorine atom. Additionally, the presence of the butoxy group can influence its solubility in organic solvents and its reactivity. The compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research and development. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or environmental impact.
Formula:C10H14ClNO
InChI:InChI=1S/C10H14ClNO/c1-8(2)4-6-13-10-7-9(11)3-5-12-10/h3,5,7-8H,4,6H2,1-2H3
InChI key:InChIKey=RGZFVNDIYLFRMO-UHFFFAOYSA-N
SMILES:O(CCC(C)C)C1=CC(Cl)=CC=N1
Synonyms:
  • 4-Chloro-2-(3-methylbutoxy)pyridine
  • Pyridine, 4-chloro-2-(3-methylbutoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.