CAS 1346948-93-3

5-Bromo-4-cyclopropyl-1H-1,2,3-triazole

Description:

5-Bromo-4-cyclopropyl-1H-1,2,3-triazole is a heterocyclic compound characterized by the presence of a triazole ring, which consists of three nitrogen atoms and two carbon atoms in a five-membered ring structure. The bromine substituent at the 5-position and the cyclopropyl group at the 4-position contribute to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure suggests potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The triazole moiety is known for its biological activity, making this compound of interest in medicinal chemistry and drug development. Additionally, 5-Bromo-4-cyclopropyl-1H-1,2,3-triazole may exhibit properties such as antimicrobial or antifungal activity, although specific biological assays would be necessary to confirm these effects. Overall, its unique structural features and potential applications make it a compound of interest in various fields of research.

Formula: C₅H₆BrN₃

InChI: InChI=1S/C5H6BrN3/c6-5-4(3-1-2-3)7-9-8-5/h3H,1-2H2,(H,7,8,9)

InChI key: InChIKey=NNXCZGVLWBNSOY-UHFFFAOYSA-N

SMILES: BrC1=C(NN=N1)C2CC2

Synonyms:

• 1H-1,2,3-Triazole, 5-bromo-4-cyclopropyl-
• 5-Bromo-4-cyclopropyl-1H-1,2,3-triazole