
CAS 134701-51-2
:4-Ethynyl-4-piperidinol
Description:
4-Ethynyl-4-piperidinol is a chemical compound characterized by its unique structure, which includes a piperidine ring substituted with an ethynyl group and a hydroxyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the ethynyl group contributes to its reactivity, making it a useful intermediate in organic synthesis. Additionally, the hydroxyl group can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 4-Ethynyl-4-piperidinol is a compound of interest in both research and industrial applications, particularly in the fields of drug development and organic synthesis.
Formula:C7H11NO
InChI:InChI=1S/C7H11NO/c1-2-7(9)3-5-8-6-4-7/h1,8-9H,3-6H2
InChI key:InChIKey=GVZFMFFUAZKMOB-UHFFFAOYSA-N
SMILES:C(#C)C1(O)CCNCC1
Synonyms:- 4-Piperidinol, 4-ethynyl-
- 4-Ethynyl-4-piperidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.