CymitQuimica logo

CAS 134705-49-0

:

2,4,6,8-tetrachlorodibenzo[b,d]thiophene

Description:
2,4,6,8-Tetrachlorodibenzo[b,d]thiophene is a synthetic organic compound characterized by its complex structure, which includes two fused benzene rings and a thiophene ring, with four chlorine substituents positioned at the 2, 4, 6, and 8 positions. This compound is part of a class of chemicals known for their potential environmental persistence and bioaccumulation. It is typically a solid at room temperature and may exhibit low solubility in water, while being more soluble in organic solvents. The presence of chlorine atoms contributes to its chemical stability and resistance to degradation. Due to its structural characteristics, it may also exhibit significant hydrophobicity, influencing its behavior in environmental contexts. Additionally, compounds of this nature are often studied for their potential toxicological effects and environmental impact, particularly in relation to their persistence in ecosystems and potential for accumulation in living organisms. Safety data sheets and regulatory guidelines should be consulted for handling and exposure information.
Formula:C12H4Cl4S
InChI:InChI=1/C12H4Cl4S/c13-5-1-7-8-2-6(14)4-10(16)12(8)17-11(7)9(15)3-5/h1-4H
SMILES:c1c(cc(c2c1c1cc(cc(c1s2)Cl)Cl)Cl)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.