CAS 134717-73-0
:(5-(3-thienyl)tetrazol-1-yl)acetic acid
Description:
(5-(3-Thienyl)tetrazol-1-yl)acetic acid is a chemical compound characterized by its unique structure, which includes a tetrazole ring and a thienyl group. The presence of the tetrazole moiety imparts notable biological activity, often associated with pharmacological properties. This compound typically exhibits moderate solubility in polar solvents due to the presence of both acidic (carboxylic acid) and heterocyclic functionalities. Its thienyl group contributes to its aromatic character, which can influence its reactivity and interaction with biological targets. The compound may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a versatile intermediate in organic synthesis. Additionally, its potential applications in medicinal chemistry are of interest, particularly in the development of new therapeutic agents. Overall, (5-(3-thienyl)tetrazol-1-yl)acetic acid is a compound of interest in both synthetic and medicinal chemistry due to its structural features and potential biological activities.
Formula:C7H6N4O2S
InChI:InChI=1/C7H6N4O2S/c12-6(13)3-11-7(8-9-10-11)5-1-2-14-4-5/h1-2,4H,3H2,(H,12,13)
SMILES:c1cscc1c1nnnn1CC(=O)O
Synonyms:- 5-(3-Thienyl)-1H-tetrazole-1-acetic acid
- 5-(3-Thienyl)tetrazol-1-ylacetic acid
- 1H-Tetrazole-1-acetic acid, 5-(3-thienyl)-
- (5-thiophen-3-yl-1H-tetrazol-1-yl)acetic acid
- (5-(3-Thienyl)tetrazol-1-yl)acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-[5-(Thiophen-3-yl)-1H-1,2,3,4-tetrazol-1-yl]acetic acid
CAS:2-[5-(Thiophen-3-yl)-1H-1,2,3,4-tetrazol-1-yl]acetic acid is a thiazolidinone derivative that has been shown to normalize peripheral nerve function in diabetic neuropathy. This drug has been shown to improve blood flow and nerve function in the sciatic nerve of diabetic rats, and to increase blood carnitine levels. 2-[5-(Thiophen-3-yl)-1H-1,2,3,4-tetrazol-1-yl]acetic acid is an analog of L -carnitine and may be used as a treatment for cardiac abnormalities caused by diabetes. It also helps decrease hyperactivity in mice with type 1 diabetes. 2-[5-(Thiophen-3-yl)-1H-1,2,3,4-tetrazol-1-yl]acetic acid is a potent inhibitor ofFormula:C7H6N4O2SPurity:Min. 95%Molecular weight:210.22 g/mol
