CAS 134720-05-1
:1-[4-(2-methoxyethyl)phenoxy]-3-[nitroso(propan-2-yl)amino]propan-2-ol
Description:
1-[4-(2-methoxyethyl)phenoxy]-3-[nitroso(propan-2-yl)amino]propan-2-ol, with the CAS number 134720-05-1, is a chemical compound that features a complex structure characterized by the presence of a phenoxy group, a nitroso group, and a secondary alcohol. This compound is likely to exhibit properties typical of both phenolic and amine functionalities, which may influence its reactivity and solubility in various solvents. The methoxyethyl substituent can enhance its lipophilicity, potentially affecting its biological activity and interaction with cellular membranes. The nitroso group may impart unique reactivity, possibly participating in nitrosation reactions or influencing the compound's stability under certain conditions. Additionally, the presence of the propan-2-ol moiety suggests that it may have applications in medicinal chemistry or as a synthetic intermediate. Overall, the specific characteristics, including its physical state, melting point, boiling point, and spectral properties, would require empirical investigation to fully understand its behavior and potential applications in various fields.
Formula:C15H24N2O4
InChI:InChI=1/C15H24N2O4/c1-12(2)17(16-19)10-14(18)11-21-15-6-4-13(5-7-15)8-9-20-3/h4-7,12,14,18H,8-11H2,1-3H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
