CymitQuimica logo

CAS 13473-53-5

:

2-(2-aminoethyl)-3-(4-chlorophenyl)-3-hydroxy-isoindolin-1-one hydrochloride

Description:
2-(2-aminoethyl)-3-(4-chlorophenyl)-3-hydroxy-isoindolin-1-one hydrochloride, with the CAS number 13473-53-5, is a chemical compound characterized by its isoindolinone structure, which features a fused bicyclic system. This compound contains an aminoethyl side chain and a hydroxyl group, contributing to its potential biological activity. The presence of a 4-chlorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in pharmaceutical formulations. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and stability, can vary based on the formulation and conditions. Safety and handling precautions are essential, as with any chemical substance, particularly in laboratory or industrial settings. Further studies would be necessary to elucidate its mechanism of action and potential therapeutic applications.
Formula:C16H16Cl2N2O2
InChI:InChI=1/C16H15ClN2O2.ClH/c17-12-7-5-11(6-8-12)16(21)14-4-2-1-3-13(14)15(20)19(16)10-9-18;/h1-8,21H,9-10,18H2;1H
SMILES:c1ccc2c(c1)C(=O)N(CCN)C2(c1ccc(cc1)Cl)O.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.