CAS 134732-52-8

(1R,5S)-2-Azabicyclo[3.1.0]hexane-1-carboxylic acid

Description:

(1R,5S)-2-Azabicyclo[3.1.0]hexane-1-carboxylic acid is a bicyclic compound characterized by its unique azabicyclic structure, which includes a nitrogen atom within a six-membered ring. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The stereochemistry indicated by the (1R,5S) configuration suggests specific spatial arrangements of the atoms, which can influence its biological activity and interactions with other molecules. The presence of the nitrogen atom in the bicyclic framework may impart basic properties, allowing it to participate in hydrogen bonding and other interactions. This compound is of interest in medicinal chemistry and pharmacology, as bicyclic structures often exhibit significant biological activity. Its potential applications may include roles as intermediates in the synthesis of pharmaceuticals or as active pharmaceutical ingredients themselves. Understanding its solubility, stability, and reactivity under various conditions is crucial for its practical applications in research and industry.

Formula: C₆H₉NO₂

InChI: InChI=1S/C6H9NO2/c8-5(9)6-3-4(6)1-2-7-6/h4,7H,1-3H2,(H,8,9)/t4-,6+/m0/s1

InChI key: InChIKey=CLPZNYCYBYIODB-UJURSFKZSA-N

SMILES: C(O)(=O)[C@]12[C@](C1)(CCN2)[H]

Synonyms:

• (1R,5S)-2-Azabicyclo[3.1.0]hexane-1-carboxylic acid
• 2-Azabicyclo[3.1.0]hexane-1-carboxylic acid, (1R,5S)-