CymitQuimica logo

CAS 134733-55-4

:

4-({(1R,2E,4E,6Z,9Z)-1-[(1S)-4-carboxy-1-hydroxybutyl]pentadeca-2,4,6,9-tetraen-1-yl}sulfanyl)benzoic acid

Description:
The chemical substance known as 4-({(1R,2E,4E,6Z,9Z)-1-[(1S)-4-carboxy-1-hydroxybutyl]pentadeca-2,4,6,9-tetraen-1-yl}sulfanyl)benzoic acid, with the CAS number 134733-55-4, is a complex organic compound characterized by its unique structural features. It contains a benzoic acid moiety linked to a long-chain polyunsaturated fatty acid derivative, which includes multiple double bonds and a sulfanyl (thioether) group. The presence of a carboxylic acid functional group suggests potential for hydrogen bonding and reactivity, while the hydroxy group enhances its solubility in polar solvents. The stereochemistry indicated by the (1R) and (1S) designations implies specific spatial arrangements that can influence the compound's biological activity and interactions. This compound may exhibit interesting properties such as antioxidant activity or potential applications in pharmaceuticals, given its structural complexity and functional groups. However, detailed studies would be necessary to fully elucidate its chemical behavior and potential uses in various fields.
Formula:C27H36O5S
InChI:InChI=1/C27H36O5S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-25(24(28)15-14-17-26(29)30)33-23-20-18-22(19-21-23)27(31)32/h6-7,9-13,16,18-21,24-25,28H,2-5,8,14-15,17H2,1H3,(H,29,30)(H,31,32)/b7-6-,10-9-,12-11+,16-13+/t24-,25+/m0/s1
Synonyms:
  • 4-{[(4S,5R,6E,8E,10Z,13Z)-1-Carboxy-4-hydroxynonadeca-6,8,10,13-tetraen-5-yl]sulfanyl}benzoic acid
  • Benzoic acid, 4-[[(1R,2E,4E,6Z,9Z)-1-[(1S)-4-carboxy-1-hydroxybutyl]-2,4,6,9-pentadecatetraen-1-yl]thio]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.