CAS 13474-14-1

Valinamide

Description:

Valinamide, with the CAS number 13474-14-1, is an organic compound characterized by its amide functional group attached to a valine derivative. It is a white to off-white crystalline solid that is soluble in water and polar organic solvents, reflecting its polar nature due to the presence of the amide group. Valinamide is known for its role in various biochemical processes and can serve as an intermediate in the synthesis of pharmaceuticals and other organic compounds. The compound exhibits properties typical of amides, such as the ability to form hydrogen bonds, which can influence its reactivity and interactions in biological systems. Additionally, valinamide may exhibit specific stereochemical configurations due to the chiral nature of valine, which can affect its biological activity and interactions with enzymes or receptors. Overall, valinamide is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its structural features and potential applications.

Formula: C₅H₁₂N₂O

InChI: InChI=1S/C5H12N2O/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H2,7,8)

InChI key: InChIKey=XDEHMKQLKPZERH-UHFFFAOYSA-N

SMILES: C(C(C)C)(C(N)=O)N

Synonyms:

• DL-Valinamide
• 2-Amino-3-methylbutanamide
• Butanamide, 2-amino-3-methyl-
• (±)-2-Amino-3-methylbutanamide
• Valinamide