CAS 134749-43-2
:4-amino-6,7-dimethoxyquinazolin-2(1H)-one hydrochloride (1:1)
Description:
4-Amino-6,7-dimethoxyquinazolin-2(1H)-one hydrochloride is a chemical compound characterized by its quinazoline core structure, which features an amino group and two methoxy groups at specific positions on the ring. This compound is typically encountered as a hydrochloride salt, indicating it is soluble in water and has enhanced stability compared to its free base form. The presence of the amino group suggests potential for hydrogen bonding and reactivity, making it of interest in medicinal chemistry, particularly for its potential biological activities. The methoxy groups can influence the compound's lipophilicity and overall pharmacokinetic properties. As a hydrochloride, it is often used in research settings for its ease of handling and formulation in various applications. The compound's CAS number, 134749-43-2, allows for precise identification in chemical databases and literature. Overall, this substance may exhibit properties relevant to drug development, particularly in the context of targeting specific biological pathways or conditions.
Formula:C10H12ClN3O3
InChI:InChI=1/C10H11N3O3.ClH/c1-15-7-3-5-6(4-8(7)16-2)12-10(14)13-9(5)11;/h3-4H,1-2H3,(H3,11,12,13,14);1H
SMILES:COc1cc2c(cc1OC)nc([nH]c2=N)O.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Doxazosin Related Compound G (4-Amino-6,7-dimethoxyquinazolin-2(1H)-one hydrochloride)
CAS:Compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure, nesoiFormula:C10H11N3O3·HClColor and Shape:White PowderMolecular weight:257.056724-Amino-6,7-dimethoxy-1H-quinazolin-2-one hydrochloride
CAS:Formula:C10H12ClN3O3Molecular weight:257.6736Terazosin Impurity 1 HCl (2-Hydroxy-4-Amino-6,7-Dimethoxy Quinazoline)
CAS:Formula:C10H11N3O3·HClColor and Shape:White To Off-White SolidMolecular weight:221.22 36.46




