CAS 13476-25-0
:Linderane
Description:
Linderane, with the CAS number 13476-25-0, is a naturally occurring sesquiterpene compound primarily derived from certain plant species, particularly those in the genus Linderina. It is characterized by its complex bicyclic structure, which contributes to its unique chemical properties. Linderane is known for its potential biological activities, including antimicrobial and anti-inflammatory effects, making it of interest in pharmacological research. The compound is typically found in essential oils and has a distinctive aroma, which may vary depending on its source. Its solubility characteristics are influenced by its hydrophobic nature, often making it more soluble in organic solvents than in water. Additionally, Linderane's stability can be affected by environmental factors such as light and temperature, which may lead to degradation or transformation into other compounds. Overall, Linderane represents a fascinating area of study within natural products chemistry, with implications for both medicinal chemistry and the development of natural fragrance compounds.
Formula:C15H16O4
InChI:InChI=1/C15H16O4/c1-8-4-3-5-15-13(19-15)12(18-14(15)16)11-9(2)7-17-10(11)6-8/h4,7,12-13H,3,5-6H2,1-2H3/b8-4+/t12-,13-,15-/m0/s1
InChI key:InChIKey=KBMSVODXFLAQNJ-JELGAPFCSA-N
SMILES:O=C1C23[C@H](O2)[C@@](O1)(C4=C(OC=C4C)C/C(/C)=C\CC3)[H]
Synonyms:- (10S,10aS)-5,9-dimethyl-3,6,10,10a-tetrahydro-2H-10,1a-(epoxymethano)oxireno[4,5]cyclodeca[1,2-b]furan-12-one
- (1aS,10S,10aS)-5,9-dimethyl-3,6,10,10a-tetrahydro-2H-10,1a-(epoxymethano)oxireno[4,5]cyclodeca[1,2-b]furan-12-one
- (1aS,4E,10S,10aS)-3,6,10,10a-Tetrahydro-5,9-dimethyl-2H-10,1a-(epoxymethano)oxireno[4,5]cyclodeca[1,2-b]furan-12-one
- 2H-10,1a-(Epoxymethano)oxireno[4,5]cyclodeca[1,2-b]furan-12-one, 3,6,10,10a-tetrahydro-5,9-dimethyl-, [1aS-(1aR*,4E,10R*,10aR*)]-
- 2H-10,1a-(Epoxymethano)oxireno[4,5]cyclodeca[1,2-b]furan-12-one,3,6,10,10a-tetrahydro-5,9-dimethyl-, (1aS,4E,10S,10aS)-
- 4β<span class="text-smallcaps">H</span>-Germacra-1(10),7,11-trien-15-oic acid, 4,5β:8,12-diepoxy-6α-hydroxy-, γ-lactone, (E)-
- Linderane
- 4βH-Germacra-1(10),7,11-trien-15-oic acid, 4,5β:8,12-diepoxy-6α-hydroxy-, γ-lactone, (E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Linderane
CAS:Linderane (LDR), a furan-containing sesquiterpenoid, is found in Lindera aggregata (Sims) Kosterm, a common traditional Chinese herbal medicine, was characterized as a mechanism-based inactivator of CYP2C9.Formula:C15H16O4Purity:95%~99%Color and Shape:PowderMolecular weight:260.289Linderane
CAS:1. Linderane was characterized as a mechanism-based inactivator of CYP2C9.Formula:C15H16O4Purity:98.25% - 99.96%Color and Shape:SolidMolecular weight:260.29Linderane
CAS:LactoneFormula:C15H16O4Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:260.29Linderane
CAS:Controlled ProductApplications Linderane is a sequiterpene lactone extract from Lindera strychnifolia compound used as a cytotoxic agent against hepaic stellate cells.
References Liu, Q. et al.: Phytochem., 87, 112 (2013); Fong, P. et al.: Nat. Prod. Comm., 7, 1287 (2012);Formula:C15H16O4Color and Shape:Off-WhiteMolecular weight:260.29Linderane
CAS:Linderane is a bioactive compound, specifically a sesquiterpene lactone, which is extracted from the roots of plants belonging to the Lindera genus. The source of Linderane is primarily the roots of these plants, which are rich in diverse secondary metabolites. The mode of action of Linderane involves modulation of various cellular pathways, making it a potential agent in chemopreventive and therapeutic applications. Its mechanism is thought to interfere with cancer cell proliferation and induce apoptosis through the disruption of normal cellular processes and signaling pathways.Formula:C15H16O4Purity:Min. 95%Color and Shape:SolidMolecular weight:260.29 g/mol







