CAS 13476-55-6
:hexyl 4-aminobenzoate
Description:
Hexyl 4-aminobenzoate, with the CAS number 13476-55-6, is an organic compound that belongs to the class of esters. It is characterized by the presence of a hexyl group, which is a six-carbon alkyl chain, attached to the amino group of 4-aminobenzoic acid (also known as para-aminobenzoic acid or PABA). This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. Hexyl 4-aminobenzoate is known for its applications in the cosmetic and pharmaceutical industries, particularly as a UV filter in sunscreens due to its ability to absorb ultraviolet radiation. It exhibits moderate solubility in organic solvents and limited solubility in water, which is common for many ester compounds. Additionally, it may possess mild irritant properties, necessitating careful handling in formulations. Overall, hexyl 4-aminobenzoate is valued for its functional properties in various applications, particularly in enhancing skin protection against UV exposure.
Formula:C13H19NO2
InChI:InChI=1/C13H19NO2/c1-2-3-4-5-10-16-13(15)11-6-8-12(14)9-7-11/h6-9H,2-5,10,14H2,1H3
SMILES:CCCCCCOC(=O)c1ccc(cc1)N
Synonyms:- 4-Amino-benzoic acid hexyl ester
- Benzoic Acid, 4-Amino-, Hexyl Ester
- Hexyl 4-aminobenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Aminobenzoic acid hexyl ester
CAS:4-Aminobenzoic acid hexyl ester is a cytoskeletal molecule that interacts with actin and myosin to form filaments. It has been shown to regulate transcriptional activity by reducing the level of reactive oxygen species or hydrogen peroxide, which are thought to induce cell death. 4-Aminobenzoic acid hexyl ester has also been shown to interact with imatinib, which is used in cancer treatment. This interaction may be due to the ability of 4-aminobenzoic acid hexyl ester to inhibit protein–protein interactions between proteins in the Wnt signaling pathway.Formula:C13H19NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:221.3 g/molHexyl 4-Aminobenzoate Hydrochloride
CAS:Controlled ProductApplications hexyl 4-aminobenzoate (cas# 13476-55-6) is a useful research chemical.
Formula:C13H19NO2•HClColor and Shape:NeatMolecular weight:257.76

