
CAS 134761-64-1
:3,6,9,12-Tetraoxaeicosan-1-ol, 1-methanesulfonate
Description:
3,6,9,12-Tetraoxaeicosan-1-ol, 1-methanesulfonate, identified by CAS number 134761-64-1, is a synthetic compound characterized by its unique structure, which includes a long carbon chain with multiple ether linkages and a terminal alcohol group. The presence of four ether (–O–) groups in its structure contributes to its solubility in polar solvents, while the methanesulfonate group enhances its ionic character, making it potentially useful in various applications, including as a surfactant or in drug delivery systems. This compound may exhibit properties such as low volatility and high thermal stability due to its long carbon chain. Additionally, the methanesulfonate moiety can impart biological activity, making it of interest in medicinal chemistry. Its synthesis typically involves multi-step organic reactions, and its characterization can be performed using techniques such as NMR spectroscopy and mass spectrometry. Overall, 3,6,9,12-Tetraoxaeicosan-1-ol, 1-methanesulfonate represents a versatile chemical entity with potential applications in both industrial and pharmaceutical fields.
Formula:C17H36O7S
InChI:InChI=1S/C17H36O7S/c1-3-4-5-6-7-8-9-20-10-11-21-12-13-22-14-15-23-16-17-24-25(2,18)19/h3-17H2,1-2H3
InChI key:InChIKey=DWEVEPUSHNLNJC-UHFFFAOYSA-N
SMILES:C(OCCOCCOCCOCCCCCCCC)COS(C)(=O)=O
Synonyms:- 3,6,9,12-Tetraoxaeicosan-1-ol, methanesulfonate
- 3,6,9,12-Tetraoxaeicosan-1-ol, 1-methanesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
