CAS 1347750-84-8
:4,7,10,13-Tetraoxa-16-azanonadecanoic acid, 19-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-17-oxo-, 2,3,4,5,6-pentafluorophenyl ester
Description:
4,7,10,13-Tetraoxa-16-azanonadecanoic acid, 19-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-17-oxo-, 2,3,4,5,6-pentafluorophenyl ester is a complex organic compound characterized by its unique structure, which includes multiple functional groups such as esters, amides, and heterocycles. The presence of tetraoxa and azanona segments indicates a polyether and amine functionality, contributing to its potential solubility in various solvents. The pentafluorophenyl ester moiety suggests high reactivity and potential applications in medicinal chemistry or materials science due to the electron-withdrawing nature of fluorine atoms, which can enhance the compound's stability and reactivity. This compound may exhibit interesting biological activities owing to its intricate structure, which could influence its interaction with biological targets. Additionally, the presence of a pyrrole derivative may impart unique electronic properties, making it a candidate for further research in drug development or as a synthetic intermediate in organic synthesis. Overall, its complex architecture and functional diversity make it a subject of interest in various fields of chemistry.
Formula:C24H27F5N2O9
InChI:InChI=1S/C24H27F5N2O9/c25-19-20(26)22(28)24(23(29)21(19)27)40-18(35)4-7-36-9-11-38-13-14-39-12-10-37-8-5-30-15(32)3-6-31-16(33)1-2-17(31)34/h1-2H,3-14H2,(H,30,32)
InChI key:InChIKey=SERXRSAEZBDOQG-UHFFFAOYSA-N
SMILES:O(C(CCOCCOCCOCCOCCNC(CCN1C(=O)C=CC1=O)=O)=O)C2=C(F)C(F)=C(F)C(F)=C2F
Synonyms:- Perfluorophenyl 19-(2,5-dioxo-2H-pyrrol-1(5H)-yl)-17-oxo-4,7,10,13-tetraoxa-16-azanonadecan-1-oate
- 4,7,10,13-Tetraoxa-16-azanonadecanoic acid, 19-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-17-oxo-, 2,3,4,5,6-pentafluorophenyl ester
- Maleimide-NH-PEG4-CH2CH2COOPFP Ester
- Mal-NH-PEG4-CH2CH2COOPFP ester
- (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4,7,10,13-Tetraoxa-16-azanonadecanoic acid, 19-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-17-oxo-, 2,3,4,5,6-pentafluorophenyl ester
CAS:Formula:C24H27F5N2O9Molecular weight:582.4712Mal-NH-PEG4-CH2CH2COOPFP ester
CAS:Mal-NH-PEG4-CH2CH2COOPFP ester is a polyethylene glycol (PEG) based linker employed in the synthesis of proteolysis-targeting chimeras (PROTACs)[1].Formula:C24H27F5N2O9Purity:98%Color and Shape:SolidMolecular weight:582.47Perfluorophenyl 19-(2,5-dioxo-2H-pyrrol-1(5H)-yl)-17-oxo-4,7,10,13-tetraoxa-16-azanonadecan-1-oate
CAS:<p>Perfluorophenyl 19-(2,5-dioxo-2H-pyrrol-1(5H)-yl)-17-oxo-4,7,10,13-tetraoxa-16-azanonadecan-1-oate is a synthetic compound, which is derived through a series of complex organic syntheses involving perfluorinated reagents. This compound is meticulously designed to incorporate both perfluorinated aromatic groups and a flexible, polyether-based linker. The mode of action for this compound primarily revolves around its unique chemical structure, which facilitates interactions at the molecular level that can be favorable for a variety of biochemical applications.</p>Formula:C24H27F5N2O9Purity:Min. 95%Molecular weight:582.5 g/mol


