CAS 13478-50-7
:Thiosulfuric acid (H2S2O3), lead(2+) salt (1:1)
Description:
Thiosulfuric acid (H2S2O3), lead(II) salt, commonly referred to as lead thiosulfate, is an inorganic compound characterized by its formation from thiosulfuric acid and lead ions. This salt typically appears as a white or colorless solid and is known for its relatively low solubility in water. Lead thiosulfate can be utilized in various applications, including analytical chemistry and as a reagent in certain chemical syntheses. The compound exhibits properties typical of lead salts, such as potential toxicity and environmental concerns due to the presence of lead, which is a heavy metal. It is important to handle this substance with care, following appropriate safety protocols to minimize exposure. In terms of stability, lead thiosulfate can decompose under certain conditions, releasing sulfur dioxide and other products. Overall, while it has specific uses in laboratory settings, the health and environmental implications associated with lead compounds necessitate cautious handling and disposal practices.
Formula:H2O3S2·Pb
InChI:InChI=1S/H2O3S2.Pb/c1-5(2,3)4;/h(H2,1,2,3,4);
InChI key:InChIKey=NNGIUXNUOGRHIH-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)S.[Pb]
Synonyms:- Thiosulfuric acid lead(2+) salt
- Thiosulfuric acid (H2S2O3), lead(2+) salt (1:1)
- Lead thiosulfate (PbS2O3)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
